Đề thi thử THPT Quốc Gia 2020 môn Hóa Học Sở GDĐT Ninh Bình lần 2

Cho biết nguyên tử khối của các nguyên tố: H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu […]

930

Tải xuống tải liệu này bằng cách nhấn vào link tải bên dưới! Toàn bộ tài liệu trên website SinhvienUDN.COM Đều là miễn phí. Các bạn có tài liệu hay có thể chia sẻ về cho SinhvienUDN thông qua fanpage: https://www.facebook.com/sinhviendoc/.

Hầu hết tài liệu trên https://sinhvienudn.com nhận được từ các bạn đọc đóng góp về. Nếu phát hiện tài liệu nào vi phạm bản quyền các bạn vui lòng liên hệ cho nhóm Admin. Nhóm sẽ kiểm tra và gỡ bỏ tài liệu xuống. Xin chân thành cảm ơn!

Cho biết nguyên tử khối của các nguyên tố:
H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.

Các thể tích khí đều đo ở điều kiện tiêu chuẩn; giả thiết các khí sinh ra không tan trong nước.
Câu 41: Xà phòng hóa este CH3COOCH2CH3 bằng dung dịch NaOH, thu được muối có công thức là
A. CH3CH2COONa.                 B. C2H5OH.                                   C. CH3ONa.                                       D. CH3COONa.
Câu 42: Thủy phân hoàn toàn chất béo C17H33COOC3H5(OOCC15H31)2 trong dung dịch NaOH dư, không thu được chất nào sau đây?
A. C3H5(OH)3.                      B. C15H31COONa.                            C. C17H35COONa.                            D. C17H33COONa.
Câu 43: Kết tủa xuất hiện khi nhỏ dung dịch brom vào
A. metyl amin.                      B. benzen.                            C. anilin.                            D. axit axetic.
Câu 44: Chất nào sau đây là muối axit?
A. KNO3.                            B. NaHSO4.                            C. NaCl.                                  D. KOH.
Câu 45: Chất nào sau đây không có tính lưỡng tính?
A. Al2O3.                            B. NaHCO3.                            C. AlCl3.                                  D. Al(OH)3.
Câu 46: Chất rắn không tan được trong dung dịch HCl dư là
A. NaCl.                              B. Ca(NO3)2.                            C. BaSO4.                               D. CaCO3.
Câu 47: Dung dịch BaCl2 tạo kết tủa với chất nào sau đây ở nhiệt độ thường?
A. NaHCO3.                       B. NaCl.                                   C. Na2SO4.                            D. NaOH.
Câu 48: Cho các chất dưới đây, chất nào có phân tử khối M = 146 gam/mol
A. glyxin.                            B. lysin.                                     C. valin.                                 D. alanin.
Câu 49: Nhôm không khử được oxit nào dưới đây ở điều kiện thích hợp?
A. CuO.                              B. Fe2O3.                                    C. Na2O.                              D. FeO.
Câu 50: Ở nhiệt độ thường, dung dịch FeCl3 không phản ứng với chất nào sau đây?
A. Fe.                                 B. Ag.                                            C. Cu.                                 D. Mg.
Câu 51: Công thức của sắt (III) hiđroxit
A. Fe(OH)2.                        B. Fe2O3.                                  C. Fe(OH)3.                          D. FeO.
Câu 52: Dung dịch nào sau đây tác dụng được với CaO, CaCO3 nhưng không tác dụng được với dung dịch AgNO3?
A. HCl.                               B. CH3COOH.                             C. C2H5OH.                        D. NaOH.